10. Acetylene gas, C2H2, can be prepared by the following reaction: CaC2(s)+2H2O(0)Ca(OH)2(s)+C2H2(g) Calculate the volume of C2H2 that is collected over water at 21.0C by reaction of 3.26g of CaC if the total pressure of the gas is 748 torr? (Use appendix B for water vapor pressure.) 11. A hydrocarbon is composed of 85.7%C and 14.3%H by mass. If 1.56grams of the hydrocarbon has a volume of 1.00L, at 0.984atm and 50.0C, what is the molecular formula of this hydrocarbon? Give a possible diagram of the molecule. 12. Which gas will diffuse faster: N2 or Kr ? How many times faster? 13. Refer to the four closed flasks of equal volume. a. In which flask do the molecules have the greatest average speed? b. Which flask contains the smallest number of moles of gas? c. Which flask contains the sample with the greatest density