2. Consider the following reaction, for which H>0, at equilibrium in a 10L container. Fe2O3(s)+3H22Fe(s)+3H2O(l) (a) Write out the expression for the equilibrium constant, K. K= How do (i) the equilibrium mass of Fe(s) and (ii) the numerical value of the equilibrium constant change with the following changes in reaction conditions? Circle the appropriate choice and discuss the reasons for your answer. (b) The reaction temperature is lowered. (c) The volume of the reactor is increased to 20L (with no change in temperature or number of moles of reactants). MassofFe(s):ValueofK:IncreasesIncreasesDecreasesDecreasesStaysthesameStaysthesame (d) Additional H2O() is added. Mass of Fe(s) : Increases Decreases Stays the same Value of K : Increases Decreases Stays the same (e) What is the sign of G