22. For all questions involving calculations, write out any equations used in the solution. (a) The main component of sugar, glucose (C6H12O6), is fully oxidised in the body according to the reaction: C6H12O6(s)+6O2(g)6CO2(g)+6H2O(l) Use the information in Table 1 to solve the next four problems. Table 1. Physical constants for the products and reactants of complete glucose combustion at 310K and 1 bar. (i) Calculate the standard enthalpy change for the reaction (3 marks) (rH). (ii) Calculate the standard entropy change for the reaction (2 marks) (+S). (iii) Calculate the standard Gibbs energy for the reaction (rG) (3 marks) at the reference temperature of 310K. (iv) Calculate the percentage of daily energy intake from a (2 marks) spoonful of sugar that weighs 4.0g. Assume the average person's daily energy intake is 2.2102kcal. 1 cal equals exactly 4.184J. (b) Hydroxyapatite, Ca5(PO4)3OH, is a mineral component of bone. It is weakly soluble in water, forming equilibrium with its constituent ions: Ca5(PO4)3OH(s)5Ca2+(aq)+3PO43(aq)+ OH(aq). The dimensionless solubility constant, Ksp, for this equilibrium is 1058.4 at 298K. (i) Write a DIMENSIONLESS equation for Kss. Assume the (4 marks) solid is pure and the solution behaves ideally. (ii) Calculate concentration of Ca2+ ions in the solution in (6 marks) equilibrium with water buffered to stay at pH7.0