(3 pts) HMX is also called otogen, its molecular formula is C4H8N5O8. It can undergo the following decomposition reaction. C4H8N5O8(s)4N2(g)+4H2O(g)+4CO2(g) During an experiment, a sample of HMX is decomposed. At the moment the explosion occumed, the pressure is 21.51GPa, the temperature is 485.6C. A. (3pts) It the teaperature is only 311.0C, what will be the partial pressure CO2(g) of the sane experiment? atmi