(3.21b Modified) One method to remove metals from water is to raise the pH and cause them to precipitate as their metal hydroxides. Hydroxide precipitation of cadmium, a toxic heavy metal, proceeds as per the following reaction: Cd2++2OHCd(OH)2(s)Ksp=1.821014 If dissolved cadmium is precipitated from solution by raising the pH, what would the dissolved cadmium concentration (mg/L) if the final pH is 8.0