Answer the following questions about the conversion of the sucrose (C12H22O11) in sugarcane to ethanol (C2H6O) and CO2 according to the following unbalanced equation. This conversion allows for sugarcane to be used as a renewable source of ethanol, a fuel additive in gasoline. sucroseC12H22O11(s)+H2O(l)C2H6O(l)+CO2(g) a. What is the molar mass of sucrose? g/mol b. Balance the given equation. C12H22O11(s)+H2O(l) c. How many moles of ethanol are formed from 1 mol of sucrose? mol ethanol d. How many moles of water are needed to react with 25mol of sucrose? mol water e. How many grams of ethanol are formed from 0.310mol of sucrose? g ethanol f. How many grams of ethanol are formed from 46.6g of sucrose? g ethanol g. What is the theoretical yield of ethanol in grams from 20.7g of sucrose? g ethanol h. If 3.48g of ethanol are formed in the reaction in part (g), what is the percent yield of ethanol