Calculate the enthaipy of the reaction 2NO(g)+O2(g)2NO2(g) Hess's law states that "the heat released or absorbed in a chemical process is the same given the following reactions and enthapies of formation: whether the process takes place in one or in several steps." It is important to recall the following rules: A. 21N2(g)+O2(g)NO2(g),fHA=33.2kJmol1 1. When two reactions are added, their enthalpy values are added. B. 21N2(g)+21O2(g)NO(g),fHB=90.2kJmol1 2. When a reaction is reversed, the sign of its enthalpy value changes. 3. When the coefficients of a reaction are multiplied by a factor, the enthalpy value is multiplied by that same factor. Hess's law states that "the heat released or absorbed in a chemical process is the same whether the process takes place in one or in several steps." It is important to recall the following rules: given the following pertinent information: 1. When two reactions are added, their A. B2O3(s)+3H2O(g)3O2(g)+B2H6(g),tHA=+2035kJmol1 B. 2B(s)+3H2(g)B2H6(g),3HB=+36kJmol1 c. H2(g)+21O2(g)H2O(l), D. H2O(l)H2O(g)1 PHC0=285kJmol1 enthalpy values are added. 2. When a reaction is reversed, the sign of its enthalpy value changes: 3. When the coetticients of a reaction are muliplied by a factor, the enthalpy value is mulriptied by that same factor