Experimental data for the liquid phase reaction of an equimolar mixture of trimethylamine and n-propyl bromide: N(CH3)3+CH3CH2CH2Br(CH3)3(CH2CH2CH3)N+Br are shown in the Table below. An examination of the underlying chemistry suggests that the kinetics would be best described by either a first-order or second-order reaction mechanism: i) dtdCtrimethylamine=k1Ctrimethylamine ii) dtdCtrimethylamine=k2CtrimethylamineCn-propylbromide A) Evaluate the time required to convert 90% of the trimethylamine to the product using both kinetic schemes (using the best-fit values of the kinetic parameters based on the data). B) Evaluate the time required to convert 99% of the trimethylamine to the product using both kinetic schemes (using the best-fit values of the kinetic parameters based on the data). C) Comment on the different time estimates obtained in parts A and B for the two kinetic models. Why are the models so similar for the 90% conversion but so different for the 99%