Only solve question 2 please! Using the answer from question 1 in calculations when needed.

1. Using the enthalpies of formation given below, calculate Hrxn in kJ, for the following reaction. Report your answer to two decimal places in standard notation. C8H16(I)+12O2(g)8CO2(g)+8H2O(I) C8H16(I):121.87kJ/molO2(g):0.00kJ/molCO2(g):393.51kJ/molH2O(I):285.83kJ/mol -5312.85 kJ Computer's answer now shown above. You are correct. Your receipt no. is 1525950 (7) 2. Calculate the amount of heat absorbed/released (in kJ ) when 15.97 grams of CO2 are produced via the above reaction. Report your answer to two decimal places, and use appropriate signs to indicate heat flow direction