please answer all parts fully and show all work, thank you so much!

1. (a) Determine the enthalpy of combustion of C3H6:2C3H6(g)+O2(g)CO2(g)+H2O (I) from the following information. (1) 3C(s)+3H2(g)C3H6(g)H=+53.3kJ/mol (3) C(s)+O2(g)CO2(g)H=393.5kJ/mol (b) Assuming that the reaction [bolded in part (a) ] took place in a rigid container, what would happen to the partial pressure of oxygen as the reaction reestablishes equilibrium IF i. Amount of O2 is increased Explain: [Place all answers on the TEST PAPER] ii. Amount of H2O was increased Explain: iii. The temperature is increased. iv. Add a platinum catalyst to the system (c) Write the Kp expression for the bolded reaction in part (a). (d) If you were trying to determine the Kc for the reaction, the n would be: (show your work)