Please write clearly. Thank you in advance!

Metal hydrides react with water to form hydrogen gas and metal hydroxide. For example, SrH2(s)+2H2O(l)Sr(OH)2(s)+2H2(g) You wish to calculate the mass of hydrogen gas that can be prepared from 4.10g of SrH2 and 3.42gof2O. Part 1 of 4 How many moles of H2 can be produced from the given mass of SrH2 ? Be sure your answer has the correct number of significant figures. moles How many moles of H2 can be produced from the given mass of H2O ? Be sure your answer has the correct number of significant figures. moles What is the limiting reactant? Enter the chemical formula. How many grams of H2 can be produced? Be sure your answer has the correct number of significant figures. g