Tutored Practice Problem 3.3.4 Use reaction stoichiometry to calculate amounts of reactants and products. The substances benzene (C6H6) and oxygen gas react to form carbon dioxide and water. Unbalanced equation: C6H6(I)+O2(g)CO2(g)+H2O(g) In one reaction, 51.2g of H2O is produced. What amount (in mol) of O2 was consumed? What mass (in grams) of CO2 is produced? mol O2 consumed gCO2 produced