Which of the following molecules has the highest bp? CH3OHCH3CH2OHCH3(CH2)6NH2 Select one: CH3CH2OH CH3(CH2)6NH2 CH3OH Clear my choice Rank the compounds below in order of decreasing boiling point (highest to fowest). [Your answer should include >, for example, A>B>C (no space)] Amide compounds (amides with at least 1NH ) generally have lower melting point than comparable compounds with ketone functional group (assuming that both are similar in size)? Select one: True False