1) (1 pt) Write the letter of your choice: which of the following types of solids is most likely to have a low melting point and not conduct electricity when melted? a) ionic solid b) molecular solid c) network covalent solid d) metallic solid 2) (4 pts) Write the formulae of all the compounds below that are highly soluble in water. BaCO3Pb(NO3)2Na2CrO4Ca3(PO4)2 3) (2 pts) For the following reaction, write the complete and balanced molecular equation. For full credit be sure to indicate the phase of your products (e.g. (aq), (s), (g)). (NH4)2S(aq)+AlCl3(aq) 4) (2+3=5 pts) Calculate the molality (m) of a solution of 92gNaCl(MW=58.45g/mol) added to 2.2 L of water (1.0L=1.0kg ). b) Calculate the TB for the solution. See the top of the page for useful information. 5) (2+1+3+28pts) Consider the following reaction O2(g)+2SO2(g)2SO3(g)Kc=6.2107 a) If the rate of formation of SO3 is 4.7102M/s, determine the rate of consumption of O2. b) Determine the rate of the reaction. c) Write the equilibrium constant expression for the reaction. d) At the beginning of the reaction, the molarity of O2 is 0.501M, that of SO2 is 0.132M. After the reaction is complete the concentration of O2 is 0.411M. Calculate the concentration of SO3 at equilibrium