(1) NH3+CH3CH2ClCH3CH2NH2+HCl One problem with this synthesis route is that the reaction is not very selective, and ammonia may react with two chloroethane molecules to form diethylamine ( (CH3CH2)2NH). (2) NH3+2CH3CH2Cl(CH3CH2)2NH+2HCl A mixture of x1=0.460molNH/mol,x2=0.460molCHCH2Cl/mol, and the remainder inerts is fed into a reactor. Within the reactor, the fractional conversion of CH3CH2Cl is 0.800 and the fractional yield of CH3CH2NH2 is 0.490. [Fractional yield is the (moles of desired product formed)/(moles of product possible for complete conversion of the feed to the desired product). Assume a 100mol basis for the feed stream, and calculate the number of moles of each component entering the reactor and leaving in the product stream. Here is the process flow diagram for reference. How many moles of NH3 enter the reactor? n1=molNH3 How many moles of CH3CH2Cl enter the reactor? n2=molCH3CH2Cl How many moles of inerts enter the reactor? n3=molinerts How many moles of inerts leave the reactor? n6=molinerts How many moles of CH3CH2Cl leave the reactor? n5=molCH3CH2Cl How many moles of CH3CH2NH2 leave the reactor? n7=molCH3CH2NH2 How many moles of (CH3CH2)2NH leave the reactor? n9=mol(CH3CH2)2NH How many moles of NH3 leave the reactor? n4=molNH3 How many moles of HCl leave the reactor