1. The following reaction is at equilibrium H2(g)+CO2(g)H2O(g)+CO(g). a. Determine the free energy change, G, at T=298K. b. If the partial pressures of H2(g),CO2(g),H2O(g), and CO(g) are 20,40,0.04, and 0.02atm, respectively, determine the free energy change as a function of temperature, G(T). 2. In human bodies, energy is generated when glucose is oxidized in the metabolic reaction C6H12O6(s)+6O2(g)=6H2O()+6CO2(g). At T=298K, the standard enthalpy change for the reaction is H=2801kJ/mol. The absolute entropy S and molecular masses for the substances are given by a. Calculate the entropy change S for the glucose oxidization reaction. b. Calculate the free energy change G, at T=298K. c. Calculate the equilibrium constant of the reaction Keq. d. Calculate the energy generated by oxidizing a 10g piece of glucose