1. The molecular formula C3H6Br2 is that of 2,2-Dibromopropane, but it could also be that of other organic molecules. What type of isomerism is being described in this situation? Draw all possible isomers of the compound. (3 points) 2. Explain how an enantiomer and a diastereomer differ from each other. Give an example of an everyday object that might help you better illustrate the difference between these two types of isomers. ( 2 points) 3. Write structural formulas and the IUPAC names for three constitutional (i.e. structural) isomers with the molecular formula C9H20. (3 points) 4. Write structural formulas and IUPAC names for the two geometric isomers of 2,3-dibromo-2hexene. (2 points) 5. Give the systematic names for each of the following: ( 0.5 points each) a. CH3CH2C(CH3)2CH(CH2CH3)CH3 b. CH3C(CH3)CH2 c. CH3CH2OH d. CH3CHC(CH3)CH2CH3 e. CH3CH(NH2)CH2CH2CH3 f. CH3CH(CH3)CH2COOH 8. CH3OCH2CH2CH2CH3 6. Write the structural formulas and IUPAC names of isomers with the same molecular formula as C5H12O for: (1 point each) a. one primary alcohol b. one secondary alcohol c. one tertiary alcohol 7. Explain the difference between a secondary amide and a secondary amine. Your explanation must contain an example of each. (1.5 points) 8. Draw both the condensed (i.e. CH3CH2CH3 ) and the structural formula (hand-drawn) for each of the following compounds: ( 2 points each) a. 2,2-dimethyl-3-ethylpentane b. 2,3-butandiol c. trans-5-methyl-2-heptene d. 6-chloro-2-methyl-3-heptyne e. 1,2-dicholorobenzene 9. Aspartame is an artificial sweetener that became increasingly common in the 1990's. Below you will find the structure of aspartame. Circle all of the functional groups found on this molecule, and clearly name each functional group. (5 points)