15. Given the following data for this reaction: NH4+(aq)+NO2(aq)N2(g)+2H2O(l) The rate law for the reaction is: a. Rate =k[NH4+][NO2] b. Rate =k[NH4+]2[NO2]2 c. Rate =k[NH4+]2[NO2] d. Rate =k[NH4+][NO2]2 e. none of the above 16. The reaction that represents the standard enthalpy of formation for acetone (CH3COCH3), a common ingredient in nail polish remover is: a. 3C (graphite) +3H2(g)+1/2O2(g)CH3COCH3(l) b. 6C (diamond )+6H2(g)+O2(g)2CH3COCH3(l) c. 3C( diamond )+3H(g)+1/2O2(g)CH3COCH3(l) d. CH3COCH3(l)3C (qraphite )+3H2(g)+1/2O2(g) e. CH3COCH3(l)+4O3(g)3CO2(g)+3H2O(g)