19. The following reactions also contribute to the formation of acid rain. SO2 is released from burning coal and other fossil fuels that contain sulfur impurities. The SO2 reacts with atmospheric oxygen to produce SO3, which can then condense to form sulfuric acid. i) 2SO2(g)+O2(g)2SO3(g)K=2.71012 at 298K ii) SO3(g)+H2O(1)H2SO4(I)K=2.21014 at 298K a) (2 pts.) Using the law of mass action, write equilibrium equations for both reactions. b) (3 pts.) For reaction (i), H=198kJ/mol. Exhaust fumes from the combustion of fossil fuels are much warmer than 298K. Do you expect this higher temperature to effect the equilibrium? CIRCLE: (i) YES, shift left (ii) YES, shift right (iii) NO shift c) (6 pts.) As the exhaust gases enter the atmosphere, they quickly cool. In the upper atmosphere, where clouds form, the temperature is typically around 248K. Calculate the equilibrium constant for reaction (i) at this temperature