4. At equilibrium at 120C, a 7.80L flask contains: 0.195 mol of PCl50.120mol of H2O0.120mol Of HCl0.430mol of POCl3 Calculate the Keq for the reaction: PCl5(s)+H2O(g)2HCl(g)+POCl3(g) [HCl]2[POCl3] 5. Consider the following equilibrium: 2SO2(g)+O2(g)2SO3(g) When a 0.860 moles of SO2 and 0.860 moles of O2 are placed into a 4.80 litre container and allowed to reach equilibrium, the equilibrium [SO3] is to be 0.0580M. Calculate the Keq value