8. Consider the balanced equation: SiO(s)+3C(s)siC(s)+2CO(g) Cumalose tha fallowine tahle showine the aporopriate number of moles of reactants and products. 9. Hydrobromic acid dissolves solid iron according to the reaction: Fe(s)+2HBr(aq)FeBr(aq)+H2(g) What mass in grams of HBr do you need to dissolve a 3.2g pure iron bar on a padlock? What mass of H2 would the complete reaction of the iron bar produce? 10. For each of the reactions, calculate the mass in grams of the product that forms when 3.67g of the underlined reactant completely reacts. Assume that there is more than enough of the other reactant. a. Ba(s)+Cl2(g)BaCl(s) b. CaO(s)+CO2(g)CaCO3(s) c. 2Mg(s)+O2(g)2MgO(s) d. 4Al(s)+3O2(g)2Al2O3(s)