ANSWER ALLLLLL NEED ASAP

Ammonia reacts with O2 to form either NO(g) or NO2(g) according to these unbalanced equations: NH3(g)+O2(g)NO(g)+H2O(g)NH3(g)+O2(g)NO2(g)+H2O(g) In a certain experiment 2.00 moles of NH3(g) and 10.00 moles of O2(g) are contained in a closed flask. After the reaction is complete, 6.95 moles of O2(g) remains. Calculate the number of moles of NO(g) in the product mixture: (Hint: You cannot do this problem by adding the balanced equations, because you cannot assume that the two reactions will occur with equal probability.) molNO Acrylonitrile (C3H3N) is the starting material for many synthetic carpets and fabrics. It is produced by the following reaction. 2C3H6(g)+2NH3(g)+3O2(g)2C3H3N(g)+6H2O(g) If 15.09C3H6,10.0gO2, and 5.00gNH3 are reacted, what mass of acrylonitrile can be produced, assuming 100% yield? Mass= 10 item altempts remaining The aspirin substitute, acetaminophen (C8H9O2N), is produced by the following three-step synthesis: i. C6H5O3N(s)+3H2(g)+HCl(aq)C6H8ONCl(s)+2H2O(l) ii. C6H8ONCl(s)+NaOH(aq)C6H7ON(s)+H2O(l)+NaCl(aq) iii. C6H7ON(s)+C4H6O3(l)C8H9O2N(s)+HC2H3O2(l) The first two reactions have percent yields of 88% and 93% by mass, respectively. The overall reaction yields 8.0 moles of acetaminophen product for every 11 moles of C6H5O3N reacted. a. What is the percent yield by mass for the overall process? Percent yield = b. What is the percent yield by mass of Step III? Percent yield = 10 item aftempts remaining The reaction between potassium chlorate and red phosphorus takes place when you strike a match on a matchbox. If you were to react 48.4 g of potassium chlorate (KClO3) with excess red phosphorus, what mass of tetraphosphorus decaoxide (P4O10) could be produced? KClO3(s)+P4(s)P4O10(s)+KCl(s) (unbalanced) Mass=