At 2000C the equibrium constant for the resction is Ke=2.4103, 2NO(g)mtN2(g)+O2(g) If the initial concentration of NO is 0.150M, what are the equilibrium concintrations of NO, N2 and O2 ? [O2] [N2]XM [NO] XM 06/0.11 Points] 2/4 Submissions Used At 80C,Kc=1.87103 for the following reaction. PH3BCO2(s)=PH3(g)+BCl3(g) (a) Calculate the equilibrium concentrations of PH3 and BC3 if a sold sample of PH3BCl3 is placed in a closed vessel and decompeses until equlibrium is reachad. [PH3] [BCl3] M N (b) If the flask has a volume of 0,100L what is the minimum mass of PH3BO (s) that must be added to the flask in order to achieve equilibrium? Your response differs from the correct answer by more than 100%.9