At 80C,Kc=1.87101 for the following reaction. PPH3BCl3(g)=PH3(g)+BCl3(g) (a) Calculate the equilibrium concentrations of PH3 and BCl if a solid sample of PH3BCl is placed in a closed vessel and decomposes until aquilibrium is reached. [PH1] [BCl3] (b) If the fask has a volume of 0.550L, what is the minimura mass of PHjBCl (s) that must be added to the flask in order to achieve equilibrum