At a certain temperature the rate of this reaction is first order in NH4OH with a rate constant of 0.00550.5 : NH4OH(aq)NH3(aq)+H2O(aq) Suppose a vessel contains NH4OH at a concentration of 1.14.M. Calculate the concentration of NH4OH in the vessel 190 . seconds later. You may assume no other reaction is important. Round your answer to 2 significant digits. ClCH2CH2Cl(g)CH2CHCl(g)+HCl(g) Suppose a vessel contains ClCH2CH2Cl at a concentration of 0.720M. Calculate the concentration of ClCH2CH2Clinthevessel2.90secondslatec,Youmay assume no other reaction is important. Round your answer to 2 significant digits. A certain reaction is known to have an activation energy Ea=24.0kJ/mol. Furthermore, the rate of this reaction is measured at 369.K and found to be 4.0106M/s. Use this information to answer the questions in the tabie below. A certain reaction is known to have an activation energy Ea=24.0 kJ/mol. Furthermare, the rate of this reaction is measured at 369. K and found to be 4.0106 M/5. Use this information to answer the questions in the table below. At a certain temperature this reaction follows second-order kinetics with a rate constant of 3.50M1/1 : 2SO3(g)2SO2(g)+O2(g) Suppose a vestel contains SO3 at a concentration of 0.200M. Calculate the concentration of SO3 in the vessel 8.10 seconds later. You may assume no other reaction is important. Round your answer to 2 significant digits