Calorimetry Question 500g of an unknown material, initially at 10C, is added to a 850mL container of water that is at 68.86C. The final temperature of the system is 60C. How much energy was transferred to the water? What is the unknown material? [ 4 marks] Hess's Law with Reactions [4 marks] The total reactants and products add up to the following equation: CH4(g)+NH3(p)HCN(g)+3H2(g) Calculate the enthalpy value for this reaction using the following equations [4 marks]: i. H2(g)+2C(s)+N2(g)2HCNH=270kJ ii. N2(g)+3H2(g)2NH3(g)AH=92kJ iii. C(s)+2H2(m)CH4(m)AHH=75kJ