Choose reagents from the following list which will lead to an effective synthesis as shown below. List the letters for each reagent, in the correct order, with no spaces or commas between them $($for example, BD represents a two$-$step synthesis that begins with reagent B and concludes with reagent D$).$ A reaction is shown. The starting reagent is a molecule with a SMILES string of C$1$CCC$($CC$1)$CC$($Br$)$Br$,$ a reaction arrow is shown and another reaction arrow is shown below and slightly offset from the first, the product is a molecule with a SMILES string of C$1$CCC$($CC$1)$CCBr$.$ A$)$ Br$2,$ CCl$4$ B$)$ NaNH$2(1$ equiv.$)$ C$)$ excess NaNH$2,$ followed by H$2$O D$)$ CH$3$I E$)$ CH$3$CH$2$I F$)$ CH$3$CH$2$CH$2$Br G$)$ H$2$SO$4$ H$)$ Na$,$ NH$3($liq$.)$ I$)$ H$2,$ Pt J$)$ H$2,$ Lindlar's catalyst K$)$ HBr L$)$ HBr$,$ ROOR M$)$ O$3,$ followed by DMS N$)$ O$3,$ followed by H$2$O