classify them PLEASE!!

freezing water to form ice a. S0 Moisture condenses on the outside of a cold glass melting ice to form water seperating solute particles throughout a solvent mixing of two gases into one container 2NO2(g)N2O4(g)C2H4(g)+H2(g)>C2H6(g) Raindrops form in a cloud CaO(s)+2HCl(g)CaCl2(s)+H2O(l) dissolution of solid KCl in water Air is pumped into a tire Sugar dissolves in coffee PCl3(g)+Cl2(g)PCl5(g) Frost forms on the windshield of your car Ni(s)+2HCl(aq)H2(g)+NiCl2(aq) Gasoline vaporizes in the carburetor of an automobile engine boiling water to form steam 2Hg(l)+O2(g)>2HgO(s)BaF2(s)>Ba2+(aq)+2F(aq)SO2(g)+CaO(s)>CaSO3(s)