During the hydration reaction of ethylene to ethanol in the vapor phase, diethylether is produced as a by-product. by-product: C2H4+H2OC2H5OH2C2H4+H2O(C2H5)2O A stream of 100 moles containing 60% ethylene, 3% inert and 37% water is fed to the reactor. The product stream has 83.57 moles with the following composition: 53.89% ethylene, 14.37% ethanol, 1.80% diethylether, 26.35% water and 3.59% inerts. 1) The ethylene conversion (\%). 2) The ethanol yield expressed as kg ethanol produced/kg ethylene fed. 3) The selectivity of the ethanol 4) Calculate the mass composition of the product stream in an inert-free basis