(five marks) Use the following information to answer the next question. Methanol is known to be the simplest alcohol, and is used as an antifreeze agent, a solvent, a fuel and a denaturant for ethyl alcohol. It is also known as wood spirit, as it is obtained from the pyrolysis of food. Today it is prepared as: CO(g)+2H2(g)CH3OH() Calculated, using the following data, what would be the enthalpy change for the reaction? (i) C(graphite)+21O2(g)CO(g) H=110.5kJ/mol (ii) C(eraplite)+O2(g)CO2(g) H=393.5kJ/mol (iii) H2(g)+21O2(g)H2O() H=285.9kJ/mol (iv) CH3OH()+33O2(g)CO2(g)+2H2O (I) H=726.6kJ/mol