help

3. Lactic acid fermentation is the conversion of sugars to lactic acid. The chemical reaction is C6H2O6(s)2CH3CH(OH)COOH(C) Calculate the standard reaction enthalpy for the reaction above using the standard enthalpies of combustion of solid glucose, C6H12O6(s) and solid lactic acid, CH2CH(OH)COOH(C) which are 2808kJ/mol and 1343.98kJ/mol respectively and the standard enthalpy of fusion of lactic acid which is 11.34kJ/mol. Show all reactions and calculations below