Hess's law states that 'the heat released or absorbed in a chemical process is the same whether the process takes place in one or in Calculate the enthalpy of the reaction several steps." It is important to recall the following rules: 1. When two reactions are added, their enthalpy values are added. 2. When a reaction is reversed, the sign 2NO(g)+O2(g)2NO2(g) of its enthalpy value changes. 3. When the coefficients of a reaction are multiplied by a tactor, the enthalpy value is multiplied by that same factor. Part B Calculate the enthalpy of the reaction 4B(s)+3O2(g)2B2O3(s) given the following pertinent information: A. B2O3(s)+3H2O(g)3O2(g)+B2H6(g),HA=+2035kJ B. 2B(s)+3H2(g)B2H6(g), C. H2(g)+21O2(g)H2O(l), D. H2O(l)H2O(g), HCa=285kJ Express your answer with the appropriate units