i need help on 13 and 14 thank you!

13. When NH4HS(s) is placed in a 1.0 - L container at 24C, the following equilibrium is reached: NH4HS(s)NH3(g)+H2S(g)Kc=1.6104 Calculate the equilibrium concentration of NH3(g). A) 1.6104 B) 3.2104 C) 8.0105 D) 1.3102 E) 2.6108 4. Consider the following reaction: NH4HS(s)NH3(g)+H2S(g) If the value of Kp for this reaction is 0.11 at 300K, calculate the equilibrium partial pressure of NH3(g) starting from pure NH4HS(s). A) 0.33atm B) 0.22atm C) 0.012atm D) 0.055atm E) 0.11atm