I need help with this two part question please.

4. Consider the following gas phase esterification reaction, where butanoic acid (CaH7CO2Hth reacts with ethanol (C2H2OH) to produce the ester, ethyl butanoate (C3H7COO2C2H5) and water. C3H7CO2H(s)+C2H5OH(m)C3H7CO2C2H5sg+H2O(s) In three separate experiments, all at the same temperature, equilibrium was achieved and the followinn data was collected. Calculate the equilibrium constant Kc at this temperature. Using the reaction and the value of Kc determined in question 4 , calculate the concentration of each substance present at equilibrium when 2M butanoic acid and 1M ethanol are mixed at the same temperature