Need help.

1. CH2=CHCH3+H2 Propene 2. CH2=CHCH3+HOH Propene 3. Structure of Toluene :- 4. What results from the polymerization of ethene? 5. The reaction of an alkene and water in the presence of an acid catalyst to produce an alcohol is called 6. IUPAC name for ethylene is 7. How many covalent bonds does a C atom always have? Write their IUPAC names. 8. CH3CH(CH3)CH2CH2CH=CHCH2CH3 9. CH3CH2C(Cl)=CH(Br) 10. CH3CH(CH3)C(CH3)(Cl)CH=CHCH3