please answer all parts fully and show all work, thank you so much!

5. CH3CH(OH)COOH(aq)+H2O(1)CH3CH(OH)COO1 (aq) +H3O1+ (aq) Lactic acid, CH3CH(OH)COOH, is a carboxylic acid that reacts with water according to the equation above. At 55C, the pH of a 50.0mL sample of 0.200MCH3CH(OH)COOH is 1.48. a. Identify the Bronsted Lowry conjugated acid-base pair in the reaction. Clearly label which is the acid and which is the base in the balanced, chemical reaction. b. Determine the value of Ka for Lactic acid at 55C. c. Determine the percent dissociation of the lactic acid at 55C. c. If 0.500MHBr is added to the system at 55C. Determine the i. pH of the resulting mixture ii. percent dissociation once the HBr has been added. Explain why the percent dissociation has changed