please help will upvote !

1. Name the following compound using IUPAC name ( 1 point) 2. Give the IUPAC name for the following compound. Draw the Lewis structure starting from left most carbon and make sure each carbon forms 4 single bonds. Usually alkyl groups as substituents are in the parentheses except one methyl group at the end of carbon chain (1 point). CH3C(CH3)2CH(CH2CH3)CH2CH2CH(CH2)CH3 3. Draw all the conformations of n-Butane using Newman projections and name all the conformations (4 points) 4. Draw the chair conformation of cyclohexane and indicate axial and equatorial hydrogens on each carbon ( 1 point) 5. Draw the two chair conformations of cis-1,3-dimethylcyclohexane and indicate which chair conformation is stable. Explain. (2 points) 6. Give the IUPAC name for the cycloalkane shown below (1 point) 7. Cyclopropane is least stable than other cycloaikanes such as cyclobutane, cyclopentane, and cyclohexane. Explain why? Your answers must be based on 1) angle strain and 2) torsional strain due to eclipsed CH bonds on each carbon/s. why cyclopentane adopts puckered structure and cyclohexane adopts chair conformations instead of planar rings. (2 points) 8. What is the general formula for Alkane? What is the general formula for cycloalkane? (1 point)