please help with these

Based on the below structure, what is the correct IUPAC name? Hint: it would be easier to name the compound from its line structure. CH3CH(CH2CH3)CH2CH(CH2CH3)CH3 2,4-diethylpentane 3,5-dimethylheptane 2-ethyl-4-methylhexane 3-methyl-5-ethylhexane Question 3 (1 point) Based on the below structure, which is the correct IUPAC name? Hint: it would be easier to name the compound from its line structure. CH3CH2CHCH3CH(CH3)2 3,4,4-trimethylbutane 3,4-dimethylpentane. 3-methylhexane 2,3-dimethylpentane