Please solve all parts a,b,c,d and e in a clear way and using paper not using a computer.

1) Determine the standard heat of reaction for each of the following reactions: a) N2(g)+O2(g)2NO(g)( ANS: 164.1KJ/mol) b) CH3CHO(g)+H2(g)C2H5OH(g) (ANS: 68.93KJ/mol) c) C2H5OH(l)+O2(g)CH3COOH(l)+H2O(l)( ANS: 492.64KJ/mol) d) C2H5CH:CH2(g)CH2:CHCH:CH2(g)+H2(g)( ANS: 109.78KJ/mol) e) C4H10(g)CH2:CHCH:CH2(g)+2H2(g) (ANS: 235.04KJ/mol ) Take Hf,ethanol(t)0=277.69KJ/mol and Hf,aceticacid(t)0=484.5KJ/mo