pls help me w this 3 questions tks a lot

A 26g sample of ammonium carbamate (NH4(NH2CO2)), was placed in an evacuated 0.25L flask and kept at 25C. At equilibrium, 15.4mg of CO2 was present. NH4(NH2CO2)(s)2NH3(g)+CO2(g). What is the value of Kc for the decomposition of ammonium carbamate into ammonia and carbon dioxide? The equilibrium constant Kc for the reaction N2(g)+O2(g)2NO(g) at 1200C is 1105. What is the equilibrium molar concentration of NO in an 11L reaction vessel that initially held 0.073mol N2 and 0.48molO2 ? Answer in units of mol/L. Answer in units of mol/L. At 760C,Kc=33.3 for the reaction PCl5(g)PCl3(g)+Cl2(g) If a mixture that consists of 0.31molPCl3 and 0.22molCl2 is placed in an 8L reaction vessel and heated to 760C, what is the equilibrium composition of PCl5 ? Answer in units of mol/L. Answer in units of mol/L