Predict and calculate the effect of volume change on an equilibrium system. Consider the equilibrium between C6H5CH2OH,C6H5CHOH and H2. C6H5CH2OH(g)C6H5CHO(g)+H2(g)K=2.61102at556K The reaction is allowed to reach equilibrium in a 5.90 - L flask. At equilibrium, [C6H5CH2OH]=0.344M, [C6H5CHO]=9.48102M and [H2]=9.48102M. (a) The equilibrium mixture is transferred to a 11.8-L flask. In which direction will the reaction proceed to reach equilibrium? (b) Caiculate the new equilibrium concentrations that result when the equilibrium mixture is transferred to a 11.8-L flask. [C6H5CH2OH]=[C6H5CHO]=M[H2]M