Q2. The KbKb of methylamine, CH3NH2CH3NH2, is 4.41044.4104 at 25C.

a) Write the equation for the hydroylsis of methylamine in water.

b) Calculate the value of GG for this reaction.

c) What is the value of G WHEN [H3O+]=67109[H3O+]=67109 M, WHEN [CH3NH+3]=24103[CH3NH3+]=24103 M, AND WHEN [CH3NH2]=98102[CH3NH2]=98102 M? Is the reaction spontaneous in the forward direction under these conditions? Justify your answer.

Q2. The Ky of methylamine, CH,NH,, is 4.4 x 10-4 at 25C. a) Write the equation for the hydroylsis of methylamine in water. b) Calculate the value of AG for this reaction. c) What is the value of AG when H30+]=6 - 7 x 10-9 M, [CH,NH]=2 - 4 x 10-3 M and [CH,NH]=9 - 8 x 10-2 M? Is the reaction spontaneous in the forward direction under these conditions? Justify your