The activation energy for the gas phase decomposition of ethyl acetate is 200kJ/mol. CH3COOC2H5CH3COOH+C2H4 The rate constant for this reaction is 7.13104s1 at 667K. What is the rate constant at 716 K? For the gas phase isomerization of dimethyl citraconate, cis-(CH3OOC)(CH3)C=CHCOOCH3trans-(CH3OOC)(CH3)C=CHCOOCH3 the rate constant at 655K is 4.16104s1 and the rate constant at 704K is 1.59103s1. What is the activation energy for this reaction? kJ/mol The activation energy for the gas phase decomposition of ethyl acetate is 200.kJ/mol. CH3COOC2H5CH3COOH+C2H4 The rate constant is 1.27104s1 at 637K. At what temperature is the rate constant 1.05103s1