The activation energy for the gas phase decomposition of t-butyl acetate is 170 kjJimal. CH2COOC(CH3)3(CH3)2C=CH2+CH2COOH The rate constant for this reactice is 7.80104s1 at 540K. What is the rate constant. at: 572K ? Use the References to access impertant values if needed for this question. For the gas phase isomerization of cis-1,2-diphenylethene, cis-C6H5CH=CHC6H5transC6H5CH=CHC6H5 the rate constant at 581K is 4.65104s1 and the rate constant at 619 is 4.52103 51. What is the activation energy for this reaction? k.)/mol