Trichloroethylene, a widely used degreasing solvent for machine parts, is produced in a two-step reaction sequence. Ethylene is first chlorinated to yield tetrachloroethane, which is dehydrochlorinated to form trichloroethylene. (1) C2H4(g)+2Cl2C2H2Cl4(l)+H2(g)Hr1=385.76kJ (2) C2H2Cl4(l)C2HCl3(l)+HCl(g) The standard heat of formation of liquid trichloroethylene is 276.2kJ/mol. Physical Property Tables Use the given data and tabulated standard heats of formation of ethylene and hydrogen chloride to calculate the standard heat of formation of tetrachloroethane and the standard heat of the second reaction. H^fC2H2C4=kJ/mol Hr2= Use Hess's law to calculate the standard heat of the reaction (3) C2H4(g)+2Cl2(g)C2HCl3(l)+H2(g)+HCl(g) If 345.0mol/h of C2HCl3(l) is produced in the reaction of Part (b) and the reactants and products are all at 25.00C and 1.000 atm, how much heat is evolved or absorbed in the process? (Assume Q=H; pay attention to the sign.)