1) Determine the standard heat of reaction for each of the following reactions: a) N2(g)+O2(g)2NO(g) (ANS: 164.1KJ/mol ) b) CH3CHO(g)+H2(g)C2H5OH(g) (ANS: 68.93KJ/mol ) c) C2H5OH(l)+O2(g)CH3COOH(l)+H2O(l)( ANS: 492.64KJ/mol) d) C2H5CH:CH2(g)CH2:CHCH:CH2(g)+H2(g) (ANS: 109.78KJ/mol) e) C4H10(g)CH2:CHCH:CH2(g)+2H2(g) (ANS: 235.04KJ/mol ) 2) Ethylene gas and steam at 593.15K(320C) and atmospheric pressure are fed to a reaction process as an equi-molar mixture. The process produces ethanol with complete conversion by the reaction: C2H4(g)+H2O(g)C2H5OH(l) The liquid ethanol exits the process at 298.15K(25C). What is the heat transfer associated with this overall process per mole of ethanol produced? Calculate using Heat of Reaction method and Heat of Formation method. Take CP=A+BT and Hfeethanol0=277.69KJ/mol. (HINT: Take 100mol basis). (ANS: 119.84KJ/mol ) 3) Ammonia gas enters the reactor of a nitric acid plant mixed with 30% more dry air than is required for the complete conversion of the ammonia to nitric oxide and water vapour. If the gases enter the reactor at 348.15K, if conversion is 80%, if no side reactions occur, and if the reactor operates adiabatically, what is the temperature of the gases leaving the reactor? Assume ideal gases and take CP=A. 4NH3(g)+5O2(g)4NO(g)+6H2O(g) (ANS: 2560.2K ) 4) One method for the manufacture of "Synthesis gas" (a mixture of CO and H2 ) is the catalytic reforming of CH4 with stream at high temperature and atmospheric pressure CH4+H2O(g)CO(g)+3H2(g) The only side reaction to be considered is: CO(g)+H2O(g)CO2(g)+H2(g) If the reactants is supplied in the ratio, 2mol steam to 1molCH4 and if heat is supplied to the reactor so that the products reach a temperature of 1300K, the CH4 is completely converted and the product stream contains 17.4mol%CO. Assuming the reactants to be preheated to 600K, calculate the heat requirement for the reactor. Calculate using Heat of Reaction method and Heat of Formation method