A chemistry graduate student is studying the rate of this reaction: ClCH2CH2Cl(g)CH2CHCl(g)+HCl(g) He fills a reaction vessel with ClCH2CH2Cl and measures its concentration as the reaction proce Use this data to answer the following questions. \begin{tabular}{|l|l|} \hline Write the rate law for this reaction. & rate =k[0 \\ \hline Calculate the value of the rate constant k. \\ Round your answer to 2 significant digits. Also be \\ sure vour answer bas the correct unit symbol. \end{tabular}