Balance the following refox reactions using half reactions

Balancing Redox Reactions Using Half Reactions 1)Write the unbalanced ionic reaction. 2iWrite the half reactions for the oxidation and reduction. 3)Balance the atoms being oxidired and redueed. (You may seed to check the oxidation numbers to be sure which ones they are.) 4) Balance axygen by adding water to the other side of the equation. 5) Balance the hydrogen atons oo each side by adding Ht. (If the reaction is in base, nest add enough OH - to each side to neutralize all the H+.) 6) Balance the charge on both sides of each half-reaction by adding electrons. The net charge on both sides of each equation should be equal. 7) If necessary, malaiply one or boch balf-reactions by a fachor that will make electrons lost = electrons gained, 8) Add the half-reactions together, caacel iny common terms, including clectrons, and make sure any remaining atoms are also balinced 1. Balance the following reaction using half reactions: I2(s)+Cl2(aq)Cl(aq)++IO3(aq)(inacid) Half reactions to use (put them in correct order) IO3+6H+5eI2(s)+3H2O(l)2ClCl2(s)+2e Half Reactions used: Cathode: 103+4H7+5eI2(9)+3h20(0) Anode: 2ClCltL)+2e Balanced Reaction: 2. Use the half-reaction method to balance the following reaction: Au3++IAu(s)+I2(s) Half Reactions: Cathode: Anode: Balanced Reaction: 3. Use the half reactions below to help balance the following redox reaction. Cr3O22(aq)+HNO2(aq)Cr3(aq)+NO22(aq)(inacid) Half Reactions to use: NOl+3H++2eHNO2(aq)+H2OCiCr2O7++14H+8e2Cr++7H2O(1) Half reactions used