In the process, 535 lb/h of fresh Ca(C2H3O2)2 and enough H2SO4 to be in 10.0% excess for converting the fresh Ca(C2H3O2)2 is fed into the reactor. The single pass conversion of Ca(C2H3O2)2 in the reactor is 90.0%. Determine the amount of Ca(C2H3O2)2 recycled and the production rate of C2H4O2 by performing the given steps.

To find the production rate of C2H4O2,C2H4O2, first calculate the flow rate of fresh Ca(C2H3O2)2Ca(C2H3O2)2 in lbmol/h. ________

For every poundmole (lbmol) of fresh Ca(C2H3O2)2Ca(C2H3O2)2 that enters the process, how many poundmoles of C2H4O2C2H4O2 leave the process?_________

What is the flow rate of C2H4O2C2H4O2 in the product stream in lbmol/h? ____________

Acetic acid can be produced through the given balanced reaction and with the process shown in the image. Ca(C2H3O2)2+H2SO4CaSO4+2C2H4O2 To find the production rate of C2H4O2, first calculate the flow rate of fresh Ca(C2H3O2)2 in lbmol/h. flow rate: lb-mol Ca(C2H3O2)2/h Incorrect For every pound-mole (lb-mol) of fresh Ca(C2H3O2)2 that enters the process, how many pound-moles of C2H4O2 leave the process? amount leaving: lb- molC2H4O2 Incorrect What is the flow rate of C2H4O2 in the product stream in lb-mol/h? flow rate: lb-mol C H2H4O2/h Incorrect