Please present answer in equation form like in the picture

This question will walk you through the steps of determining which reactant is limiting based on a balanced chemical equation. Step 2a: Use dimensional analysis to determine the theoretical yield of the product. Calculate the theoretical yield in from the complete combustion of according to the following balanced chemical equation: CH4(g)+O2(g)CO2(g)+H2O(I)